Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0296 |
| Product Name | 5-Amino-4-Chloro-O-Cresol |
| CAS | 110102-86-8 |
| Structure |  |
| Synonyms | 2-Methyl-4-chloro-5-aminophenol |
| IUPAC Name | 5-amino-4-chloro-2-methylphenol |
| Molecular Weight | 157.6 g/mol |
| Molecular Formula | C7H8ClNO |
| InChI | InChI=1S/C7H8ClNO/c1-4-2-5(8)6(9)3-7(4)10/h2-3,10H,9H2,1H3 |
| InChI Key | WDQMXRWYXILWPT-UHFFFAOYSA-N |
| Boiling Point | 289 °C |
| Flash Point | 128°C |
| Purity | 95% |
| Density | 1.33 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=CC(=C(C=C1O)N)Cl |
| pKa | 9.94±0.23 |
If you have any questions, please contact us. You will get a satisfactory answer.
