Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1253 |
| Product Name | Aleuritic Acid |
| CAS | 533-87-9 |
| Structure |  |
| Synonyms | 8,9,15-Trihydroxypentadecane-1-carboxylicacid |
| IUPAC Name | (9R,10S)-9,10,16-trihydroxyhexadecanoic acid |
| Molecular Weight | 304.42 g/mol |
| Molecular Formula | C16H32O5 |
| InChI | InChI=1S/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21)/t14-,15+/m1/s1 |
| InChI Key | MEHUJCGAYMDLEL-CABCVRRESA-N |
| Boiling Point | 365 °C |
| Melting Point | 100-101 °C |
| Purity | 95% |
| Density | 1.08 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.008 |
| Isomeric SMILES | C(CCC[C@H]([C@H](CCCCCCO)O)O)CCCC(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
