Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1294 |
| Product Name | Alanyl Glutamine |
| CAS | 39537-23-0 |
| Structure |  |
| Synonyms | L-Alanyl-L-glutamine;L-Glutamine, N2-L-alanyl-;L-Alanyl L-glutamine |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid |
| Molecular Weight | 217.22 g/mol |
| Molecular Formula | C8H15N3O4 |
| InChI | InChI=1S/C8H15N3O4/c1-4(9)7(13)11-5(8(14)15)2-3-6(10)12/h4-5H,2-3,9H2,1H3,(H2,10,12)(H,11,13)(H,14,15)/t4-,5-/m0/s1 |
| InChI Key | HJCMDXDYPOUFDY-WHFBIAKZSA-N |
| Boiling Point | 615 °C |
| Melting Point | 215 °C |
| Purity | 95% |
| Density | 1.31 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Isomeric SMILES | C[C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)N |
| pKa | 3.12±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
