Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1300 |
| Product Name | Adenine |
| CAS | 73-24-5 |
| Structure |  |
| Synonyms | Purine, 6-amino-;9H-Purin-6-amine |
| IUPAC Name | 7H-purin-6-amine |
| Molecular Weight | 135.13 g/mol |
| Molecular Formula | C5H5N5 |
| InChI | InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10) |
| InChI Key | GFFGJBXGBJISGV-UHFFFAOYSA-N |
| Purity | 95% |
| Density | 1.38 g/mL |
| Appearance | Liquid or Solid |
| Highest Usage In Residency Products | 0.0125 |
| Isomeric SMILES | C1=NC2=NC=NC(=C2N1)N |
| pKa | 4.12 |
If you have any questions, please contact us. You will get a satisfactory answer.
