Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1283 |
| Product Name | Acetyl Tyrosine |
| CAS | 537-55-3 |
| Structure |  |
| Synonyms | N-Acetyl-L-tyrosine |
| IUPAC Name | (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoic acid |
| Molecular Weight | 223.23 g/mol |
| Molecular Formula | C11H13NO4 |
| InChI | InChI=1S/C11H13NO4/c1-7(13)12-10(11(15)16)6-8-2-4-9(14)5-3-8/h2-5,10,14H,6H2,1H3,(H,12,13)(H,15,16)/t10-/m0/s1 |
| InChI Key | CAHKINHBCWCHCF-JTQLQIEISA-N |
| Boiling Point | 364.5 °C |
| Melting Point | 149-152 °C |
| Purity | 95% |
| Density | 1.24 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.03 |
| Isomeric SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O |
| pKa | 3.15±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
