Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0138 |
| Product Name | Acetyl tetrapeptide 15 |
| CAS | 928007-64-1 |
| Structure |  |
| Synonyms | N-Acetyl-L-tyrosyl-L-prolyl-L-phenylalanyl-L-phenylalaninamide |
| IUPAC Name | (2S)-1-[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]-N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide |
| Molecular Weight | 613.7 g/mol |
| Molecular Formula | C34H39N5O6 |
| InChI | InChI=1S/C34H39N5O6/c1-22(40)36-29(21-25-14-16-26(41)17-15-25)34(45)39-18-8-13-30(39)33(44)38-28(20-24-11-6-3-7-12-24)32(43)37-27(31(35)42)19-23-9-4-2-5-10-23/h2-7,9-12,14-17,27-30,41H,8,13,18-21H2,1H3,(H2,35,42)(H,36,40)(H,37,43)(H,38,44)/t27-,28-,29-,30-/m0/s1 |
| InChI Key | BSXFOBDOGHFWOC-KRCBVYEFSA-N |
| Boiling Point | 1055.2±65.0 °C |
| Purity | 0.95 |
| Appearance | White powder |
| Storage | -15~-20 °C |
| Isomeric SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)N |
| pKa | 9.84±0.15 |
| Safety | No heavy metals, no skin and eye irritation |
What is the chemical formula of Acetyl tetrapeptide 15?
The chemical formula of Acetyl tetrapeptide 15 is C34H39N5O6.
What is the molecular weight of Acetyl tetrapeptide 15?
The molecular weight of Acetyl tetrapeptide 15 is 613.7.
What is the boiling point of Acetyl tetrapeptide 15?
The boiling point of Acetyl tetrapeptide 15 is predicted to be 1055.2±65.0 °C.
What is the usage of Acetyl tetrapeptide 15 in cosmetics?
Acetyl tetrapeptide-15 is used in cosmetics for sensitive skin, as it reduces skin hyperreactivity and inflammatory, chronic, and neuropathic pain.
What is the recommended dosage of Acetyl tetrapeptide 15 in cosmetics?
The recommended dosage of Acetyl tetrapeptide 15 in cosmetics is 0.2~6%.
How does Acetyl tetrapeptide 15 benefit the skin?
Acetyl tetrapeptide 15 is a super anti-allergic peptide that is potent in anti-inflammation, decreasing nerve sensitivity, improving skin tolerance threshold, anti-itching, anti-aching, and preventing and relieving irritant symptoms.
What is the general description of Acetyl tetrapeptide 15?
Acetyl tetrapeptide 15 is the reaction product of acetic acid and Tetrapeptide 15. It is a polypeptide that improves the skin's tolerance to environmental factors, alleviating discomfort caused by cosmetics and skin treatments.
What pathway does Acetyl tetrapeptide 15 act on to reduce skin hyperreactivity?
Acetyl tetrapeptide-15 raises the excitatory threshold of μ-opioid receptor neurons via an endorphin-like pathway.
How does Acetyl tetrapeptide 15 reduce inflammatory, chronic, and neuropathic pain?
Acetyl tetrapeptide-15 decreases skin hyperreactivity and reduces inflammatory, chronic, and neuropathic pain by acting on the μ-opioid receptor neurons.
How does Acetyl tetrapeptide 15 help achieve the purpose of alleviating skin sensitivity?
Acetyl tetrapeptide 15 is similar to a natural opioid peptide that can reduce the stimulation of skin nerve endings, thereby alleviating skin sensitivity.
If you have any questions, please contact us. You will get a satisfactory answer.
