Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0164 |
| Product Name | Acetyl tetrapeptide-3 |
| CAS | 827306-88-7 |
| Structure |  |
| Synonyms | N2-Acetyl-L-lysylglycyl-L-histidyl-L-lysinamide |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-6-aminohexanamide |
| Molecular Weight | 509.6 g/mol |
| Molecular Formula | C22H39N9O5 |
| InChI | InChI=1S/C22H39N9O5/c1-14(32)29-17(7-3-5-9-24)21(35)27-12-19(33)30-18(10-15-11-26-13-28-15)22(36)31-16(20(25)34)6-2-4-8-23/h11,13,16-18H,2-10,12,23-24H2,1H3,(H2,25,34)(H,26,28)(H,27,35)(H,29,32)(H,30,33)(H,31,36)/t16-,17-,18-/m0/s1 |
| InChI Key | RRJOMESUBQAYOA-BZSNNMDCSA-N |
| Boiling Point | 1075.4±65.0 °C |
| Density | 1.25 g/mL |
| Isomeric SMILES | CC(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CC1=CN=CN1)C(=O)N[C@@H](CCCCN)C(=O)N |
| pKa | 13.35±0.46 |
If you have any questions, please contact us. You will get a satisfactory answer.
