Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Acetyl pentapeptide-1

Online Inquiry

Catalog Number	CI-BP-0088
Product Name	Acetyl pentapeptide-1
CAS	97530-32-0
Structure
Synonyms	N2-acetyl-L-arginyl-L-lysyl-L-α-aspartyl-L-valyl-L-tyrosine
IUPAC Name	(3S)-3-[[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-6-aminohexanoyl]amino]-4-[[(2S)-1-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid
Molecular Weight	721.81 g/mol
Molecular Formula	C32H51N9O10
InChI	InChI=1S/C32H51N9O10/c1-17(2)26(30(49)40-24(31(50)51)15-19-9-11-20(43)12-10-19)41-29(48)23(16-25(44)45)39-28(47)22(7-4-5-13-33)38-27(46)21(37-18(3)42)8-6-14-36-32(34)35/h9-12,17,21-24,26,43H,4-8,13-16,33H2,1-3H3,(H,37,42)(H,38,46)(H,39,47)(H,40,49)(H,41,48)(H,44,45)(H,50,51)(H4,34,35,36)/t21-,22-,23-,24-,26-/m0/s1
InChI Key	JGWAYIPLKPVOJZ-LENLALOCSA-N
Purity	0.95
Density	1.42 g/mL
Appearance	White powder
Storage	-15~-20 °C
Isomeric SMILES	CC(C)[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCN=C(N)N)NC(=O)C
pKa	3.07±0.10
Safety	No heavy metals, no skin and eye irritation

Custom Q&A

What is the chemical name of Acetyl Pentapeptide-1?

The chemical name of Acetyl Pentapeptide-1 is L-Tyrosine, N2-acetyl-L-arginyl-L-lysyl-L-α-aspartyl-L-valyl-

What is the CAS number of Acetyl Pentapeptide-1?

The CAS number of Acetyl Pentapeptide-1 is 97530-32-0.

What is the molecular formula of Acetyl Pentapeptide-1?

The molecular formula of Acetyl Pentapeptide-1 is C32H51N9O10.

What is the molecular weight of Acetyl Pentapeptide-1?

The molecular weight of Acetyl Pentapeptide-1 is 721.81.

What is the storage temperature recommended for Acetyl Pentapeptide-1?

The recommended storage temperature for Acetyl Pentapeptide-1 is -20°C.

What is the solubility of Acetyl Pentapeptide-1 in PBS (pH 7.2)?

Acetyl Pentapeptide-1 has a solubility of 10 mg/ml in PBS (pH 7.2).

How does Acetyl Pentapeptide-1 work in decreasing skin irritation?

Acetyl Pentapeptide-1 decreases IL-8 secretion in human keratinocytes when used in combination with other peptides, thus reducing skin irritation caused by cleansing.

How does Acetyl Pentapeptide-1 benefit the skin in cosmetic applications?

Acetyl Pentapeptide-1 can be absorbed by the skin easily and promote the synthesis of collagen and elastin proteins, improving skin thickness and firmness, making it suitable for anti-wrinkle products.

What is the form of Acetyl Pentapeptide-1?

Acetyl Pentapeptide-1 is in the form of a solid.

What is the predicted pKa value of Acetyl Pentapeptide-1?

The predicted pKa value of Acetyl Pentapeptide-1 is 3.07±0.10.

Online Inquiry