Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1287 |
| Product Name | Acetyl Methionine |
| CAS | 65-82-7 |
| Structure |  |
| Synonyms | N-Acetyl-L-methionine |
| IUPAC Name | (2S)-2-acetamido-4-methylsulfanylbutanoic acid |
| Molecular Weight | 191.25 g/mol |
| Molecular Formula | C7H13NO3S |
| InChI | InChI=1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 |
| InChI Key | XUYPXLNMDZIRQH-LURJTMIESA-N |
| Boiling Point | 235 °C |
| Melting Point | 103-106 °C |
| Purity | 95% |
| Density | 1.27 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0005 |
| Isomeric SMILES | CC(=O)N[C@@H](CCSC)C(=O)O |
| pKa | 3.50±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
