Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-BP-0137 |
Product Name | Acetyl hydroxyproline |
CAS | 33996-33-7 |
Synonyms | Oxaceprol |
IUPAC Name | (2S,4R)-1-acetyl-4-hydroxypyrrolidine-2-carboxylic acid |
Molecular Weight | 173.17 g/mol |
Molecular Formula | C7H11NO4 |
InChI | InChI=1S/C7H11NO4/c1-4(9)8-3-5(10)2-6(8)7(11)12/h5-6,10H,2-3H2,1H3,(H,11,12)/t5-,6+/m1/s1 |
InChI Key | BAPRUDZDYCKSOQ-RITPCOANSA-N |
Boiling Point | 303.8 °C |
Melting Point | 132-133 °C |
Purity | 0.95 |
Density | 1.3346 g/mL |
Appearance | White powder |
Storage | -15~-20 °C |
Isomeric SMILES | CC(=O)N1C[C@@H](C[C@H]1C(=O)O)O |
pKa | 3.48±0.40 |
Safety | No heavy metals, no skin and eye irritation |
What is the molecular formula of Acetyl hydroxyproline?
The molecular formula of Acetyl hydroxyproline is C7H11NO4.
What is the molecular weight of Acetyl hydroxyproline?
The molecular weight of Acetyl hydroxyproline is 173.16654.
What are the components of Acetyl hydroxyproline?
Acetyl hydroxyproline consists of carbon, hydrogen, nitrogen, and oxygen.
Can Acetyl hydroxyproline be used as a skincare ingredient?
Yes, Acetyl hydroxyproline is commonly used in skincare products for its anti-aging properties.
How is Acetyl hydroxyproline synthesized?
Acetyl hydroxyproline can be synthesized from proline through acetylation and hydroxylation reactions.
What are the potential benefits of Acetyl hydroxyproline in cosmetics?
Acetyl hydroxyproline can help improve skin elasticity, reduce fine lines and wrinkles, and enhance overall skin texture.
Is Acetyl hydroxyproline water-soluble?
Acetyl hydroxyproline is water-soluble, making it suitable for formulations such as serums and creams.
Are there any known side effects of using products containing Acetyl hydroxyproline?
There are no significant side effects associated with the use of products containing Acetyl hydroxyproline when used as directed.