Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-BP-0005 |
Product Name | Acetyl Hexapeptide |
CAS | 616204-22-9 |
Structure | |
Synonyms | Argireline |
IUPAC Name | (4S)-4-acetamido-5-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-[[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-carboxy-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
Molecular Weight | 889 g/mol |
Molecular Formula | C34H60N14O12S |
InChI | InChI=1S/C34H60N14O12S/c1-17(49)43-20(8-11-25(51)52)29(57)47-22(9-12-26(53)54)31(59)48-23(13-16-61-2)32(60)46-21(7-10-24(35)50)30(58)45-19(6-4-15-42-34(39)40)28(56)44-18(27(36)55)5-3-14-41-33(37)38/h18-23H,3-16H2,1-2H3,(H2,35,50)(H2,36,55)(H,43,49)(H,44,56)(H,45,58)(H,46,60)(H,47,57)(H,48,59)(H,51,52)(H,53,54)(H4,37,38,41)(H4,39,40,42)/t18-,19-,20-,21-,22-,23-/m0/s1 |
InChI Key | RJZNPROJTJSYLC-LLINQDLYSA-N |
Purity | 0.95 |
Density | 1.54 g/mL |
Appearance | Lyophilized solid |
Isomeric SMILES | CC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
pKa | 4.43±0.10 |
What is the chemical name for Argireline?
Acetyl Hexapeptide-3/Acetyl Hexapeptide-8
What is the molecular formula of Argireline?
C34H60N14O12S
What is the storage temperature recommended for Argireline?
-20°C
What is the color of Argireline?
White
What is the sequence of amino acids in Argireline?
Ac-Glu-Glu-Met-Gln-Arg-Arg-NH2
What can Argireline help prevent in terms of skincare?
The formation of wrinkles by inhibiting muscle movement in the face
What is another name for Argireline cream?
"Botox in a jar"
What is the recommended dosage of Argireline for reducing facial wrinkles?
3~10%
How does Argireline mimic the effects of Botox?
By interfering with the SNARE ternary complex and catecholamine release from chromaffin cells