Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0005 |
| Product Name | Acetyl Hexapeptide |
| CAS | 616204-22-9 |
| Structure |  |
| Synonyms | Argireline |
| IUPAC Name | (4S)-4-acetamido-5-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-[[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-carboxy-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| Molecular Weight | 889 g/mol |
| Molecular Formula | C34H60N14O12S |
| InChI | InChI=1S/C34H60N14O12S/c1-17(49)43-20(8-11-25(51)52)29(57)47-22(9-12-26(53)54)31(59)48-23(13-16-61-2)32(60)46-21(7-10-24(35)50)30(58)45-19(6-4-15-42-34(39)40)28(56)44-18(27(36)55)5-3-14-41-33(37)38/h18-23H,3-16H2,1-2H3,(H2,35,50)(H2,36,55)(H,43,49)(H,44,56)(H,45,58)(H,46,60)(H,47,57)(H,48,59)(H,51,52)(H,53,54)(H4,37,38,41)(H4,39,40,42)/t18-,19-,20-,21-,22-,23-/m0/s1 |
| InChI Key | RJZNPROJTJSYLC-LLINQDLYSA-N |
| Purity | 0.95 |
| Density | 1.54 g/mL |
| Appearance | Lyophilized solid |
| Isomeric SMILES | CC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
| pKa | 4.43±0.10 |
What is Acetyl Hexapeptide-8 and how does it work?
Acetyl Hexapeptide-8 is a peptide compound that mimics the N-terminal end of SNAP-25. It functions by interfering with the SNARE protein complex involved in neurotransmitter release at synapses. By competing with the natural SNAP-25 protein, Acetyl Hexapeptide-8 destabilizes the SNARE complex slightly, thereby preventing the release of acetylcholine, which in turn attenuates muscle contraction. This process leads to a relaxed muscle state, contributing to its anti-wrinkle effects.
How does Acetyl Hexapeptide-8 compare to Botulinum Toxin A in terms of muscle relaxation?
While both Acetyl Hexapeptide-8 and Botulinum Toxin A aim to reduce muscle contraction and improve the appearance of wrinkles, they operate through different mechanisms. Botulinum Toxin A works by cleaving the SNAP-25 protein irreversibly, thereby completely blocking acetylcholine release at the neuromuscular junction and leading to muscle paralysis. In contrast, Acetyl Hexapeptide-8 does not cleave or destroy any components of the SNARE complex; instead, it competes with SNAP-25, destabilizing the process of neurotransmitter release in a more reversible manner, allowing for a safer muscle relaxation and anti-wrinkle effect.
Is Acetyl Hexapeptide-8 a safer alternative to traditional wrinkle treatments?
Acetyl Hexapeptide-8 provides a safer alternative to certain traditional wrinkle treatments like Botulinum Toxin A, as it interferes with muscle contraction in a less invasive manner. While it mimics the natural protein to slightly destabilize the SNARE complex and reduce neurotransmitter release, it does not cause irreversible changes or break down essential proteins, making it a less aggressive option for achieving muscle relaxation and reducing the appearance of wrinkles.
Does Acetyl Hexapeptide-8 permanently relax muscles?
No, Acetyl Hexapeptide-8 does not permanently relax muscles. Its action is temporary and works by transiently competing with SNAP-25 during the formation of the SNARE complex, which leads to reduced neurotransmitter release and temporary muscle relaxation. Once the effect of Acetyl Hexapeptide-8 diminishes, normal muscle contraction can resume unless reapplication maintains the muscle relaxation effect.
If you have any questions, please contact us. You will get a satisfactory answer.
