Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Acetyl hexapeptide-1

Online Inquiry

Catalog Number	CI-BP-0086
Product Name	Acetyl hexapeptide-1
CAS	448944-47-6
Structure
Synonyms	N-Acetyl-L-norleucyl-L-alanyl-L-histidyl-D-phenylalanyl-L-arginyl-L-tryptophanamide
IUPAC Name	(2S)-2-acetamido-N-[(2S)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]hexanamide
Molecular Weight	870.01 g/mol
Molecular Formula	C43H59N13O7
InChI	InChI=1S/C43H59N13O7/c1-4-5-15-32(52-26(3)57)39(60)51-25(2)38(59)55-36(21-29-23-47-24-50-29)42(63)56-35(19-27-12-7-6-8-13-27)41(62)53-33(17-11-18-48-43(45)46)40(61)54-34(37(44)58)20-28-22-49-31-16-10-9-14-30(28)31/h6-10,12-14,16,22-25,32-36,49H,4-5,11,15,17-21H2,1-3H3,(H2,44,58)(H,47,50)(H,51,60)(H,52,57)(H,53,62)(H,54,61)(H,55,59)(H,56,63)(H4,45,46,48)/t25-,32-,33-,34-,35+,36-/m0/s1
InChI Key	WPIQUSRULDNCKM-IFSWANACSA-N
Purity	0.95
Density	1.39 g/mL
Appearance	White powder
Storage	-15~-20 °C
Isomeric SMILES	CCCC[C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CC1=CN=CN1)C(=O)N[C@H](CC2=CC=CC=C2)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC3=CNC4=CC=CC=C43)C(=O)N)NC(=O)C
pKa	13.36±0.46
Safety	No heavy metals, no skin and eye irritation

Custom Q&A

What is the chemical formula of Acetyl Hexapeptide-1?

The chemical formula of Acetyl Hexapeptide-1 is C43H59N13O7.

What is the molecular weight of Acetyl Hexapeptide-1?

The molecular weight of Acetyl Hexapeptide-1 is 870.01.

What are some of the amino acids that make up Acetyl Hexapeptide-1?

The amino acids that make up Acetyl Hexapeptide-1 are alanine, arginine, histidine, leucine, phenylalanine, and tryptophan.

How does Acetyl Hexapeptide-1 help skin defend itself from environmental aggressors?

Acetyl Hexapeptide-1 helps skin defend itself from environmental aggressors by providing a calming effect.

What role does Acetyl Hexapeptide-1 play in promoting a more even skin tone?

Acetyl Hexapeptide-1 promotes a more even skin tone by helping melanin move through the skin.

How does Acetyl Hexapeptide-1 interact with the skin cell receptor MC1R?

Acetyl Hexapeptide-1 interacts with the skin cell receptor MC1R to stimulate pigmentation and melanin production.

What is the application of Acetyl Hexapeptide-1 in terms of hair pigmentation?

Acetyl Hexapeptide-1 stimulates hair pigmentation, darkens hair, and reverses the gray hair process.

How does Acetyl Hexapeptide-1 help repair DNA damage caused by UV exposure?

Acetyl Hexapeptide-1 helps repair DNA damage caused by UV exposure by reducing skin erythema and protecting against DNA and free radical damage.

What is the recommended dosage range for Acetyl Hexapeptide-1?

The recommended dosage range for Acetyl Hexapeptide-1 is 0.1-5%.

How does Acetyl Hexapeptide-1 promote melanin production in hair?

Acetyl Hexapeptide-1 promotes melanin production by combining with MC1-R and transferring melanin from melanocytes to keratinocytes, coloring the hair.

Online Inquiry