Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1312 |
| Product Name | Acetyl Glucosamine |
| CAS | 10036-64-3 |
| Structure |  |
| Synonyms | 2-Acetamido-2-deoxy-α-D-glucopyranose |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| Molecular Weight | 221.21 g/mol |
| Molecular Formula | C8H15NO6 |
| InChI | InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8+/m1/s1 |
| InChI Key | OVRNDRQMDRJTHS-PVFLNQBWSA-N |
| Boiling Point | 595.4±50.0 °C |
| Melting Point | 211 °C |
| Purity | 95% |
| Density | 1.5 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.08 |
| Isomeric SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@@H]1O)CO)O)O |
| pKa | 12.04±0.70 |
If you have any questions, please contact us. You will get a satisfactory answer.
