Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1290 |
| Product Name | Acetaminophen |
| CAS | 103-90-2 |
| Structure |  |
| Synonyms | n-(Hydroxy-4phenyl)acetamide |
| IUPAC Name | N-(4-hydroxyphenyl)acetamide |
| Molecular Weight | 151.16 g/mol |
| Molecular Formula | C8H9NO2 |
| InChI | InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) |
| InChI Key | RZVAJINKPMORJF-UHFFFAOYSA-N |
| Boiling Point | 273 °C |
| Melting Point | 168-172 °C |
| Purity | 95% |
| Density | 1.29 g/mL |
| Appearance | Solid |
| Highest Usage In Rinsing Products | 0.0005 |
| Isomeric SMILES | CC(=O)NC1=CC=C(C=C1)O |
If you have any questions, please contact us. You will get a satisfactory answer.
